C12H7Cl3FN — CID 105349877
3-fluoro-4-(2,4,6-trichlorophenyl)aniline (PubChem CID 105349877) has the molecular formula C12H7Cl3FN and a molecular weight of 290.55 g/mol. Its IUPAC name is 3-fluoro-4-(2,4,6-trichlorophenyl)aniline.
| Compound Name | 3-fluoro-4-(2,4,6-trichlorophenyl)aniline |
|---|---|
| PubChem CID | 105349877 |
| Molecular Formula | C12H7Cl3FN |
| Molecular Weight | 290.55 g/mol |
| Exact Mass | 288.96 |
| IUPAC Name | 3-fluoro-4-(2,4,6-trichlorophenyl)aniline |
| SMILES | Nc1ccc(-c2c(Cl)cc(Cl)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C12H7Cl3FN/c13-6-3-9(14)12(10(15)4-6)8-2-1-7(17)5-11(8)16/h1-5H,17H2 |
| InChIKey | ZTPXGCZMMFXLRF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|