C11H5Cl3FN — CID 133090356
3-fluoro-4-(2,4,6-trichlorophenyl)pyridine (PubChem CID 133090356) has the molecular formula C11H5Cl3FN and a molecular weight of 276.52 g/mol. Its IUPAC name is 3-fluoro-4-(2,4,6-trichlorophenyl)pyridine.
| Compound Name | 3-fluoro-4-(2,4,6-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 133090356 |
| Molecular Formula | C11H5Cl3FN |
| Molecular Weight | 276.52 g/mol |
| Exact Mass | 274.95 |
| IUPAC Name | 3-fluoro-4-(2,4,6-trichlorophenyl)pyridine |
| SMILES | Fc1cnccc1-c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H5Cl3FN/c12-6-3-8(13)11(9(14)4-6)7-1-2-16-5-10(7)15/h1-5H |
| InChIKey | OKEOTCYNPKSKIF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |