C11H5Cl4N — CID 134636075
4-chloro-3-(2,4,6-trichlorophenyl)pyridine (PubChem CID 134636075) has the molecular formula C11H5Cl4N and a molecular weight of 292.98 g/mol. Its IUPAC name is 4-chloro-3-(2,4,6-trichlorophenyl)pyridine.
| Compound Name | 4-chloro-3-(2,4,6-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 134636075 |
| Molecular Formula | C11H5Cl4N |
| Molecular Weight | 292.98 g/mol |
| Exact Mass | 290.92 |
| IUPAC Name | 4-chloro-3-(2,4,6-trichlorophenyl)pyridine |
| SMILES | Clc1cc(Cl)c(-c2cnccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H5Cl4N/c12-6-3-9(14)11(10(15)4-6)7-5-16-2-1-8(7)13/h1-5H |
| InChIKey | YPRGEJPFOICWLZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.98 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |