C13H7Cl2N — CID 169447929
3-(2,4-dichlorophenyl)-4-ethynylpyridine (PubChem CID 169447929) has the molecular formula C13H7Cl2N and a molecular weight of 248.11 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-ethynylpyridine.
| Compound Name | 3-(2,4-dichlorophenyl)-4-ethynylpyridine |
|---|---|
| PubChem CID | 169447929 |
| Molecular Formula | C13H7Cl2N |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-ethynylpyridine |
| SMILES | C#Cc1ccncc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Cl2N/c1-2-9-5-6-16-8-12(9)11-4-3-10(14)7-13(11)15/h1,3-8H |
| InChIKey | YTNYODBXWULWRP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|