C24H22FN — CID 59742364
2-fluoro-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-amine (PubChem CID 59742364) has the molecular formula C24H22FN and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-fluoro-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-amine.
| Compound Name | 2-fluoro-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-amine |
|---|---|
| PubChem CID | 59742364 |
| Molecular Formula | C24H22FN |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-fluoro-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-amine |
| SMILES | CC1(C)c2cc(N)ccc2-c2cc3c(cc21)-c1ccc(F)cc1C3(C)C |
| InChI | InChI=1S/C24H22FN/c1-23(2)19-9-13(25)5-7-15(19)17-11-22-18(12-21(17)23)16-8-6-14(26)10-20(16)24(22,3)4/h5-12H,26H2,1-4H3 |
| InChIKey | SRMINLXCMCANMG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|