C25H21F2N3 — CID 175308054
2-[2,4-bis(4-fluoro-3,5-dimethylphenyl)phenyl]-1,3,5-triazine (PubChem CID 175308054) has the molecular formula C25H21F2N3 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[2,4-bis(4-fluoro-3,5-dimethylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[2,4-bis(4-fluoro-3,5-dimethylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 175308054 |
| Molecular Formula | C25H21F2N3 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 2-[2,4-bis(4-fluoro-3,5-dimethylphenyl)phenyl]-1,3,5-triazine |
| SMILES | Cc1cc(-c2ccc(-c3ncncn3)c(-c3cc(C)c(F)c(C)c3)c2)cc(C)c1F |
| InChI | InChI=1S/C25H21F2N3/c1-14-7-19(8-15(2)23(14)26)18-5-6-21(25-29-12-28-13-30-25)22(11-18)20-9-16(3)24(27)17(4)10-20/h5-13H,1-4H3 |
| InChIKey | ROQMTEGFKPHUKF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |