C16H12FN3 — CID 174842436
2-(4-fluoro-3-methylphenyl)-4-phenyl-1,3,5-triazine (PubChem CID 174842436) has the molecular formula C16H12FN3 and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-(4-fluoro-3-methylphenyl)-4-phenyl-1,3,5-triazine.
| Compound Name | 2-(4-fluoro-3-methylphenyl)-4-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 174842436 |
| Molecular Formula | C16H12FN3 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-(4-fluoro-3-methylphenyl)-4-phenyl-1,3,5-triazine |
| SMILES | Cc1cc(-c2ncnc(-c3ccccc3)n2)ccc1F |
| InChI | InChI=1S/C16H12FN3/c1-11-9-13(7-8-14(11)17)16-19-10-18-15(20-16)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | AFJIUKRSEDYINX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |