C19H21N3O2 — CID 91591144
acetic acid;2,4-diphenyl-1,3,5-triazine;ethane (PubChem CID 91591144) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is acetic acid;2,4-diphenyl-1,3,5-triazine;ethane.
| Compound Name | acetic acid;2,4-diphenyl-1,3,5-triazine;ethane |
|---|---|
| PubChem CID | 91591144 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | acetic acid;2,4-diphenyl-1,3,5-triazine;ethane |
| SMILES | CC.CC(=O)O.c1ccc(-c2ncnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C15H11N3.C2H4O2.C2H6/c1-3-7-12(8-4-1)14-16-11-17-15(18-14)13-9-5-2-6-10-13;1-2(3)4;1-2/h1-11H;1H3,(H,3,4);1-2H3 |
| InChIKey | JBUZUPUNLHVYRQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |