C26H18N4 — CID 146569234
2-phenyl-4-(3-phenyl-5-pyridin-4-ylphenyl)-1,3,5-triazine (PubChem CID 146569234) has the molecular formula C26H18N4 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-phenyl-4-(3-phenyl-5-pyridin-4-ylphenyl)-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(3-phenyl-5-pyridin-4-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 146569234 |
| Molecular Formula | C26H18N4 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-phenyl-4-(3-phenyl-5-pyridin-4-ylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccncc3)cc(-c3ncnc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C26H18N4/c1-3-7-19(8-4-1)22-15-23(20-11-13-27-14-12-20)17-24(16-22)26-29-18-28-25(30-26)21-9-5-2-6-10-21/h1-18H |
| InChIKey | CBZVTMCYCCYUNF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |