C19H19N3O — CID 174946165
2,4-diphenyl-1,3,5-triazine;oxolane (PubChem CID 174946165) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 2,4-diphenyl-1,3,5-triazine;oxolane.
| Compound Name | 2,4-diphenyl-1,3,5-triazine;oxolane |
|---|---|
| PubChem CID | 174946165 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2,4-diphenyl-1,3,5-triazine;oxolane |
| SMILES | C1CCOC1.c1ccc(-c2ncnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C15H11N3.C4H8O/c1-3-7-12(8-4-1)14-16-11-17-15(18-14)13-9-5-2-6-10-13;1-2-4-5-3-1/h1-11H;1-4H2 |
| InChIKey | RMJAUMXUSIUXBS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |