C17H10F4N2 — CID 71024195
2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine (PubChem CID 71024195) has the molecular formula C17H10F4N2 and a molecular weight of 318.27 g/mol. Its IUPAC name is 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine.
| Compound Name | 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine |
|---|---|
| PubChem CID | 71024195 |
| Molecular Formula | C17H10F4N2 |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine |
| SMILES | Cc1cnc(-c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C17H10F4N2/c1-9-7-22-17(23-8-9)10-2-3-12(13(18)4-10)11-5-14(19)16(21)15(20)6-11/h2-8H,1H3 |
| InChIKey | ZTTOQPZONJGIBU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|