About 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine
2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine (PubChem CID 71024195) has the molecular formula C17H10F4N2
and a molecular weight of 318.27 g/mol. Its IUPAC name is 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine.
Molecular Properties
| Compound Name | 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine |
| PubChem CID | 71024195 |
| Molecular Formula | C17H10F4N2 |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine |
| SMILES | Cc1cnc(-c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C17H10F4N2/c1-9-7-22-17(23-8-9)10-2-3-12(13(18)4-10)11-5-14(19)16(21)15(20)6-11/h2-8H,1H3 |
| InChIKey | ZTTOQPZONJGIBU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine?
The IUPAC name of 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine (CID 71024195) is 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine.
What is the SMILES notation for 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine?
The canonical SMILES for 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine is Cc1cnc(-c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)nc1.
What is the InChIKey of 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine?
The InChIKey is ZTTOQPZONJGIBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F4N2/c1-9-7-22-17(23-8-9)10-2-3-12(13(18)4-10)11-5-14(19)16(21)15(20)6-11/h2-8H,1H3.
What are the key properties of 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine?
2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine has a molecular weight of 318.27 g/mol, XLogP of 4.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-methylpyrimidine is sourced from PubChem (CID 71024195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).