C16H9F4N3 — CID 118489503
2-[5-fluoro-6-(3,4,5-trifluorophenyl)-3-pyridinyl]-5-methylpyrimidine (PubChem CID 118489503) has the molecular formula C16H9F4N3 and a molecular weight of 319.26 g/mol. Its IUPAC name is 2-[5-fluoro-6-(3,4,5-trifluorophenyl)-3-pyridinyl]-5-methylpyrimidine.
| Compound Name | 2-[5-fluoro-6-(3,4,5-trifluorophenyl)-3-pyridinyl]-5-methylpyrimidine |
|---|---|
| PubChem CID | 118489503 |
| Molecular Formula | C16H9F4N3 |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[5-fluoro-6-(3,4,5-trifluorophenyl)-3-pyridinyl]-5-methylpyrimidine |
| SMILES | Cc1cnc(-c2cnc(-c3cc(F)c(F)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C16H9F4N3/c1-8-5-22-16(23-6-8)10-4-13(19)15(21-7-10)9-2-11(17)14(20)12(18)3-9/h2-7H,1H3 |
| InChIKey | YOGAOGRKCHTZDP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|