C21H31N3O2 — CID 140984968
2-(2,4-dihexoxyphenyl)-1,3,5-triazine (PubChem CID 140984968) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-(2,4-dihexoxyphenyl)-1,3,5-triazine.
| Compound Name | 2-(2,4-dihexoxyphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 140984968 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 2-(2,4-dihexoxyphenyl)-1,3,5-triazine |
| SMILES | CCCCCCOc1ccc(-c2ncncn2)c(OCCCCCC)c1 |
| InChI | InChI=1S/C21H31N3O2/c1-3-5-7-9-13-25-18-11-12-19(21-23-16-22-17-24-21)20(15-18)26-14-10-8-6-4-2/h11-12,15-17H,3-10,13-14H2,1-2H3 |
| InChIKey | GPVQAXINPRVACN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|