C54H68N2O4S2 — CID 90097158
4-[5-(2,4-dihexoxyphenyl)thiophen-2-yl]-2-[4-[5-(2,4-dihexoxyphenyl)thiophen-2-yl]-2-pyridinyl]pyridine (PubChem CID 90097158) has the molecular formula C54H68N2O4S2 and a molecular weight of 873.28 g/mol. Its IUPAC name is 4-[5-(2,4-dihexoxyphenyl)thiophen-2-yl]-2-[4-[5-(2,4-dihexoxyphenyl)thiophen-2-yl]-2-pyridinyl]pyridine.
| Compound Name | 4-[5-(2,4-dihexoxyphenyl)thiophen-2-yl]-2-[4-[5-(2,4-dihexoxyphenyl)thiophen-2-yl]-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 90097158 |
| Molecular Formula | C54H68N2O4S2 |
| Molecular Weight | 873.28 g/mol |
| Exact Mass | 872.46 |
| IUPAC Name | 4-[5-(2,4-dihexoxyphenyl)thiophen-2-yl]-2-[4-[5-(2,4-dihexoxyphenyl)thiophen-2-yl]-2-pyridinyl]pyridine |
| SMILES | CCCCCCOc1ccc(-c2ccc(-c3ccnc(-c4cc(-c5ccc(-c6ccc(OCCCCCC)cc6OCCCCCC)s5)ccn4)c3)s2)c(OCCCCCC)c1 |
| InChI | InChI=1S/C54H68N2O4S2/c1-5-9-13-17-33-57-43-21-23-45(49(39-43)59-35-19-15-11-7-3)53-27-25-51(61-53)41-29-31-55-47(37-41)48-38-42(30-32-56-48)52-26-28-54(62-52)46-24-22-44(58-34-18-14-10-6-2)40-50(46)60-36-20-16-12-8-4/h21-32,37-40H,5-20,33-36H2,1-4H3 |
| InChIKey | VBFGCGXVNBFMCZ-UHFFFAOYSA-N |
| XLogP | 16.77 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.28 |
| LogP ≤ 5 | 16.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|