C23H13N9 — CID 121287228
2-[2,6-bis(1,3,5-triazin-2-yl)phenanthren-9-yl]-1,3,5-triazine (PubChem CID 121287228) has the molecular formula C23H13N9 and a molecular weight of 415.42 g/mol. Its IUPAC name is 2-[2,6-bis(1,3,5-triazin-2-yl)phenanthren-9-yl]-1,3,5-triazine.
| Compound Name | 2-[2,6-bis(1,3,5-triazin-2-yl)phenanthren-9-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 121287228 |
| Molecular Formula | C23H13N9 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[2,6-bis(1,3,5-triazin-2-yl)phenanthren-9-yl]-1,3,5-triazine |
| SMILES | c1ncnc(-c2ccc3c(c2)cc(-c2ncncn2)c2ccc(-c4ncncn4)cc23)n1 |
| InChI | InChI=1S/C23H13N9/c1-3-17-16(5-14(1)21-27-8-24-9-28-21)7-20(23-31-12-26-13-32-23)18-4-2-15(6-19(17)18)22-29-10-25-11-30-22/h1-13H |
| InChIKey | VEKJVUXUMQCPBG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|