C17H11N3 — CID 174667753
2-phenanthren-1-yl-1,3,5-triazine (PubChem CID 174667753) has the molecular formula C17H11N3 and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-phenanthren-1-yl-1,3,5-triazine.
| Compound Name | 2-phenanthren-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 174667753 |
| Molecular Formula | C17H11N3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-phenanthren-1-yl-1,3,5-triazine |
| SMILES | c1ccc2c(c1)ccc1c(-c3ncncn3)cccc12 |
| InChI | InChI=1S/C17H11N3/c1-2-5-13-12(4-1)8-9-15-14(13)6-3-7-16(15)17-19-10-18-11-20-17/h1-11H |
| InChIKey | SRJAJCRNKAWJTC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|