C15H10N6 — CID 174727422
2-[7-(1,2,4-triazol-1-yl)naphthalen-2-yl]-1,3,5-triazine (PubChem CID 174727422) has the molecular formula C15H10N6 and a molecular weight of 274.29 g/mol. Its IUPAC name is 2-[7-(1,2,4-triazol-1-yl)naphthalen-2-yl]-1,3,5-triazine.
| Compound Name | 2-[7-(1,2,4-triazol-1-yl)naphthalen-2-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 174727422 |
| Molecular Formula | C15H10N6 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-[7-(1,2,4-triazol-1-yl)naphthalen-2-yl]-1,3,5-triazine |
| SMILES | c1ncnc(-c2ccc3ccc(-n4cncn4)cc3c2)n1 |
| InChI | InChI=1S/C15H10N6/c1-2-12(15-18-7-16-8-19-15)5-13-6-14(4-3-11(1)13)21-10-17-9-20-21/h1-10H |
| InChIKey | OMXPKHYUUNITEW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |