C10H8N6 — CID 71751577
1-[3-((1,2-15N2)1,2,4-triazol-1-yl)phenyl]-(1,2-15N2)1,2,4-triazole (PubChem CID 71751577) has the molecular formula C10H8N6 and a molecular weight of 216.19 g/mol. Its IUPAC name is 1-[3-((1,2-15N2)1,2,4-triazol-1-yl)phenyl]-(1,2-15N2)1,2,4-triazole.
| Compound Name | 1-[3-((1,2-15N2)1,2,4-triazol-1-yl)phenyl]-(1,2-15N2)1,2,4-triazole |
|---|---|
| PubChem CID | 71751577 |
| Molecular Formula | C10H8N6 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1-[3-((1,2-15N2)1,2,4-triazol-1-yl)phenyl]-(1,2-15N2)1,2,4-triazole |
| SMILES | c1cc(-[15n]2cnc[15n]2)cc(-[15n]2cnc[15n]2)c1 |
| InChI | InChI=1S/C10H8N6/c1-2-9(15-7-11-5-13-15)4-10(3-1)16-8-12-6-14-16/h1-8H/i13+1,14+1,15+1,16+1 |
| InChIKey | WXNXRKYXCCDJHI-FIZPRHLTSA-N |
| XLogP | 0.85 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |