C22H20N10 — CID 166216423
2-N,3-N-bis[[3-(1,2,4-triazol-1-yl)phenyl]methyl]pyrazine-2,3-diamine (PubChem CID 166216423) has the molecular formula C22H20N10 and a molecular weight of 424.47 g/mol. Its IUPAC name is 2-N,3-N-bis[[3-(1,2,4-triazol-1-yl)phenyl]methyl]pyrazine-2,3-diamine.
| Compound Name | 2-N,3-N-bis[[3-(1,2,4-triazol-1-yl)phenyl]methyl]pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 166216423 |
| Molecular Formula | C22H20N10 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-N,3-N-bis[[3-(1,2,4-triazol-1-yl)phenyl]methyl]pyrazine-2,3-diamine |
| SMILES | c1cc(CNc2nccnc2NCc2cccc(-n3cncn3)c2)cc(-n2cncn2)c1 |
| InChI | InChI=1S/C22H20N10/c1-3-17(9-19(5-1)31-15-23-13-29-31)11-27-21-22(26-8-7-25-21)28-12-18-4-2-6-20(10-18)32-16-24-14-30-32/h1-10,13-16H,11-12H2,(H,25,27)(H,26,28) |
| InChIKey | MJKUVXBAJCSDJJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |