C15H13ClN4O2S — CID 56805967
3-chloro-N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 56805967) has the molecular formula C15H13ClN4O2S and a molecular weight of 348.82 g/mol. Its IUPAC name is 3-chloro-N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56805967 |
| Molecular Formula | C15H13ClN4O2S |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 3-chloro-N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cccc(-n2cncn2)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13ClN4O2S/c16-13-4-2-6-15(8-13)23(21,22)19-9-12-3-1-5-14(7-12)20-11-17-10-18-20/h1-8,10-11,19H,9H2 |
| InChIKey | XBSJROQAICTDDO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |