C12H13N3O2 — CID 117334098
4-[3-(1,2,4-triazol-1-yl)phenyl]butanoic acid (PubChem CID 117334098) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is 4-[3-(1,2,4-triazol-1-yl)phenyl]butanoic acid.
| Compound Name | 4-[3-(1,2,4-triazol-1-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117334098 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 4-[3-(1,2,4-triazol-1-yl)phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1cccc(-n2cncn2)c1 |
| InChI | InChI=1S/C12H13N3O2/c16-12(17)6-2-4-10-3-1-5-11(7-10)15-9-13-8-14-15/h1,3,5,7-9H,2,4,6H2,(H,16,17) |
| InChIKey | USGDYVQSTCXQLI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |