C12H16N4 — CID 63943267
N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]propan-1-amine (PubChem CID 63943267) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63943267 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc(-n2cncn2)c1 |
| InChI | InChI=1S/C12H16N4/c1-2-6-13-8-11-4-3-5-12(7-11)16-10-14-9-15-16/h3-5,7,9-10,13H,2,6,8H2,1H3 |
| InChIKey | YIHCBYAQAVZPOE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|