C12H16N4O2 — CID 107409816
4-[3-(propylaminomethyl)phenyl]-1,2,4-triazolidine-3,5-dione (PubChem CID 107409816) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 4-[3-(propylaminomethyl)phenyl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-[3-(propylaminomethyl)phenyl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107409816 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-[3-(propylaminomethyl)phenyl]-1,2,4-triazolidine-3,5-dione |
| SMILES | CCCNCc1cccc(-n2c(=O)[nH][nH]c2=O)c1 |
| InChI | InChI=1S/C12H16N4O2/c1-2-6-13-8-9-4-3-5-10(7-9)16-11(17)14-15-12(16)18/h3-5,7,13H,2,6,8H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | IIPNFCUNCFBWSQ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|