C17H16ClN3O2 — CID 166214261
1-[3-[3-(4-chlorophenoxy)propoxy]phenyl]-1,2,4-triazole (PubChem CID 166214261) has the molecular formula C17H16ClN3O2 and a molecular weight of 329.79 g/mol. Its IUPAC name is 1-[3-[3-(4-chlorophenoxy)propoxy]phenyl]-1,2,4-triazole.
| Compound Name | 1-[3-[3-(4-chlorophenoxy)propoxy]phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 166214261 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1-[3-[3-(4-chlorophenoxy)propoxy]phenyl]-1,2,4-triazole |
| SMILES | Clc1ccc(OCCCOc2cccc(-n3cncn3)c2)cc1 |
| InChI | InChI=1S/C17H16ClN3O2/c18-14-5-7-16(8-6-14)22-9-2-10-23-17-4-1-3-15(11-17)21-13-19-12-20-21/h1,3-8,11-13H,2,9-10H2 |
| InChIKey | XWCJZTSTDYEOKP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|