C8H7AgN3S+ — CID 23324543
silver 3-(1,2,4-triazol-1-yl)benzenethiol (PubChem CID 23324543) has the molecular formula C8H7AgN3S+ and a molecular weight of 285.10 g/mol. Its IUPAC name is silver 3-(1,2,4-triazol-1-yl)benzenethiol.
| Compound Name | silver 3-(1,2,4-triazol-1-yl)benzenethiol |
|---|---|
| PubChem CID | 23324543 |
| Molecular Formula | C8H7AgN3S+ |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 283.94 |
| IUPAC Name | silver 3-(1,2,4-triazol-1-yl)benzenethiol |
| SMILES | Sc1cccc(-n2cncn2)c1.[Ag+] |
| InChI | InChI=1S/C8H7N3S.Ag/c12-8-3-1-2-7(4-8)11-6-9-5-10-11;/h1-6,12H;/q;+1 |
| InChIKey | OARYDOWLYPJKLL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 30.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|