C11H9N5 — CID 132570303
1-(3-imidazol-1-ylphenyl)-1,2,4-triazole (PubChem CID 132570303) has the molecular formula C11H9N5 and a molecular weight of 211.23 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylphenyl)-1,2,4-triazole.
| Compound Name | 1-(3-imidazol-1-ylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 132570303 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 1-(3-imidazol-1-ylphenyl)-1,2,4-triazole |
| SMILES | c1cc(-n2ccnc2)cc(-n2cncn2)c1 |
| InChI | InChI=1S/C11H9N5/c1-2-10(15-5-4-12-8-15)6-11(3-1)16-9-13-7-14-16/h1-9H |
| InChIKey | GSJIJWZSIIPSJG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |