C13H17N3 — CID 142158899
acetylene;1-phenyl-1,2,4-triazole;propane (PubChem CID 142158899) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is acetylene;1-phenyl-1,2,4-triazole;propane.
| Compound Name | acetylene;1-phenyl-1,2,4-triazole;propane |
|---|---|
| PubChem CID | 142158899 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | acetylene;1-phenyl-1,2,4-triazole;propane |
| SMILES | C#C.CCC.c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C8H7N3.C3H8.C2H2/c1-2-4-8(5-3-1)11-7-9-6-10-11;1-3-2;1-2/h1-7H;3H2,1-2H3;1-2H |
| InChIKey | VLSNDHNVFMIZTO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|