C20H20N8 — CID 141429794
1,4-bis[4-(1,2,4-triazol-1-yl)phenyl]piperazine (PubChem CID 141429794) has the molecular formula C20H20N8 and a molecular weight of 372.44 g/mol. Its IUPAC name is 1,4-bis[4-(1,2,4-triazol-1-yl)phenyl]piperazine.
| Compound Name | 1,4-bis[4-(1,2,4-triazol-1-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 141429794 |
| Molecular Formula | C20H20N8 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1,4-bis[4-(1,2,4-triazol-1-yl)phenyl]piperazine |
| SMILES | c1ncn(-c2ccc(N3CCN(c4ccc(-n5cncn5)cc4)CC3)cc2)n1 |
| InChI | InChI=1S/C20H20N8/c1-5-19(27-15-21-13-23-27)6-2-17(1)25-9-11-26(12-10-25)18-3-7-20(8-4-18)28-16-22-14-24-28/h1-8,13-16H,9-12H2 |
| InChIKey | KCFWYCCOYXRKGT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|