C15H19N5 — CID 75402436
(Z)-N-piperidin-1-yl-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanimine (PubChem CID 75402436) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is (Z)-N-piperidin-1-yl-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanimine.
| Compound Name | (Z)-N-piperidin-1-yl-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanimine |
|---|---|
| PubChem CID | 75402436 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (Z)-N-piperidin-1-yl-1-[4-(1,2,4-triazol-1-yl)phenyl]ethanimine |
| SMILES | C/C(=N/N1CCCCC1)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C15H19N5/c1-13(18-19-9-3-2-4-10-19)14-5-7-15(8-6-14)20-12-16-11-17-20/h5-8,11-12H,2-4,9-10H2,1H3/b18-13- |
| InChIKey | ACPRKHINTKEPTI-AQTBWJFISA-N |
| XLogP | 2.48 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|