C17H20N4O3 — CID 46524573
ethyl 1-[4-(1,2,4-triazol-1-yl)benzoyl]piperidine-3-carboxylate (PubChem CID 46524573) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is ethyl 1-[4-(1,2,4-triazol-1-yl)benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[4-(1,2,4-triazol-1-yl)benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46524573 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | ethyl 1-[4-(1,2,4-triazol-1-yl)benzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccc(-n3cncn3)cc2)C1 |
| InChI | InChI=1S/C17H20N4O3/c1-2-24-17(23)14-4-3-9-20(10-14)16(22)13-5-7-15(8-6-13)21-12-18-11-19-21/h5-8,11-12,14H,2-4,9-10H2,1H3 |
| InChIKey | OGFKTPIZRLUTIP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |