C19H26N2O5S — CID 7685705
ethyl (3R)-1-[4-(1,1-dioxothiazinan-2-yl)benzoyl]piperidine-3-carboxylate (PubChem CID 7685705) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is ethyl (3R)-1-[4-(1,1-dioxothiazinan-2-yl)benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[4-(1,1-dioxothiazinan-2-yl)benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 7685705 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | ethyl (3R)-1-[4-(1,1-dioxothiazinan-2-yl)benzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)c2ccc(N3CCCCS3(=O)=O)cc2)C1 |
| InChI | InChI=1S/C19H26N2O5S/c1-2-26-19(23)16-6-5-11-20(14-16)18(22)15-7-9-17(10-8-15)21-12-3-4-13-27(21,24)25/h7-10,16H,2-6,11-14H2,1H3/t16-/m1/s1 |
| InChIKey | HHPTZDFUHFZVQK-MRXNPFEDSA-N |
| XLogP | 2.03 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |