C9H6N4S — CID 119082517
1-(4-isothiocyanatophenyl)-1,2,4-triazole (PubChem CID 119082517) has the molecular formula C9H6N4S and a molecular weight of 202.24 g/mol. Its IUPAC name is 1-(4-isothiocyanatophenyl)-1,2,4-triazole.
| Compound Name | 1-(4-isothiocyanatophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 119082517 |
| Molecular Formula | C9H6N4S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 1-(4-isothiocyanatophenyl)-1,2,4-triazole |
| SMILES | S=C=Nc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C9H6N4S/c14-7-11-8-1-3-9(4-2-8)13-6-10-5-12-13/h1-6H |
| InChIKey | YJCYDDKGIYEQGB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|