C11H10N4O2 — CID 171871498
2,3-dihydroxy-3-[4-(1,2,4-triazol-1-yl)phenyl]propanenitrile (PubChem CID 171871498) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 2,3-dihydroxy-3-[4-(1,2,4-triazol-1-yl)phenyl]propanenitrile.
| Compound Name | 2,3-dihydroxy-3-[4-(1,2,4-triazol-1-yl)phenyl]propanenitrile |
|---|---|
| PubChem CID | 171871498 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2,3-dihydroxy-3-[4-(1,2,4-triazol-1-yl)phenyl]propanenitrile |
| SMILES | N#CC(O)C(O)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C11H10N4O2/c12-5-10(16)11(17)8-1-3-9(4-2-8)15-7-13-6-14-15/h1-4,6-7,10-11,16-17H |
| InChIKey | PQMIVEDOJHNQJU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|