C19H18N6O3 — CID 26781797
[4-(4-nitrophenyl)piperazin-1-yl]-[4-(1,2,4-triazol-1-yl)phenyl]methanone (PubChem CID 26781797) has the molecular formula C19H18N6O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is [4-(4-nitrophenyl)piperazin-1-yl]-[4-(1,2,4-triazol-1-yl)phenyl]methanone.
| Compound Name | [4-(4-nitrophenyl)piperazin-1-yl]-[4-(1,2,4-triazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 26781797 |
| Molecular Formula | C19H18N6O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | [4-(4-nitrophenyl)piperazin-1-yl]-[4-(1,2,4-triazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-n2cncn2)cc1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C19H18N6O3/c26-19(15-1-3-17(4-2-15)24-14-20-13-21-24)23-11-9-22(10-12-23)16-5-7-18(8-6-16)25(27)28/h1-8,13-14H,9-12H2 |
| InChIKey | RFIKRUAEEKPQRJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|