C20H23N5S — CID 56860748
5-[1-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-4-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 56860748) has the molecular formula C20H23N5S and a molecular weight of 365.51 g/mol. Its IUPAC name is 5-[1-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-4-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-[1-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-4-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 56860748 |
| Molecular Formula | C20H23N5S |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 5-[1-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-4-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | c1ncn(-c2ccc(N3CCC(N4CCc5sccc5C4)CC3)cc2)n1 |
| InChI | InChI=1S/C20H23N5S/c1-3-19(25-15-21-14-22-25)4-2-17(1)23-9-5-18(6-10-23)24-11-7-20-16(13-24)8-12-26-20/h1-4,8,12,14-15,18H,5-7,9-11,13H2 |
| InChIKey | IKNWAMRSKLREMY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|