About 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one
3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one (PubChem CID 42941023) has the molecular formula C11H13NO2S
and a molecular weight of 223.30 g/mol. Its IUPAC name is 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one.
Molecular Properties
| Compound Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one |
| PubChem CID | 42941023 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one |
| SMILES | O=C1OCCC1N1CCc2sccc2C1 |
| InChI | InChI=1S/C11H13NO2S/c13-11-9(2-5-14-11)12-4-1-10-8(7-12)3-6-15-10/h3,6,9H,1-2,4-5,7H2 |
| InChIKey | GUZXYDWVRNSTCG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one?
The IUPAC name of 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one (CID 42941023) is 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one.
What is the SMILES notation for 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one?
The canonical SMILES for 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one is O=C1OCCC1N1CCc2sccc2C1.
What is the InChIKey of 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one?
The InChIKey is GUZXYDWVRNSTCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2S/c13-11-9(2-5-14-11)12-4-1-10-8(7-12)3-6-15-10/h3,6,9H,1-2,4-5,7H2.
What are the key properties of 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one?
3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one has a molecular weight of 223.30 g/mol, XLogP of 1.42, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)oxolan-2-one is sourced from PubChem (CID 42941023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).