C13H16N4 — CID 117329120
1-[3-(1,2,4-triazol-1-yl)phenyl]cyclopentan-1-amine (PubChem CID 117329120) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 1-[3-(1,2,4-triazol-1-yl)phenyl]cyclopentan-1-amine.
| Compound Name | 1-[3-(1,2,4-triazol-1-yl)phenyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 117329120 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-[3-(1,2,4-triazol-1-yl)phenyl]cyclopentan-1-amine |
| SMILES | NC1(c2cccc(-n3cncn3)c2)CCCC1 |
| InChI | InChI=1S/C13H16N4/c14-13(6-1-2-7-13)11-4-3-5-12(8-11)17-10-15-9-16-17/h3-5,8-10H,1-2,6-7,14H2 |
| InChIKey | ZDBAAJLXOFLTBO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |