C15H20N4 — CID 117394631
[1-[3-(1,2,4-triazol-1-yl)phenyl]cyclohexyl]methanamine (PubChem CID 117394631) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is [1-[3-(1,2,4-triazol-1-yl)phenyl]cyclohexyl]methanamine.
| Compound Name | [1-[3-(1,2,4-triazol-1-yl)phenyl]cyclohexyl]methanamine |
|---|---|
| PubChem CID | 117394631 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | [1-[3-(1,2,4-triazol-1-yl)phenyl]cyclohexyl]methanamine |
| SMILES | NCC1(c2cccc(-n3cncn3)c2)CCCCC1 |
| InChI | InChI=1S/C15H20N4/c16-10-15(7-2-1-3-8-15)13-5-4-6-14(9-13)19-12-17-11-18-19/h4-6,9,11-12H,1-3,7-8,10,16H2 |
| InChIKey | JTCMERWBCWJWBF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |