C12H16N4O2S — CID 95971403
N-[(1R)-1-[3-(1,2,4-triazol-1-yl)phenyl]ethyl]ethanesulfonamide (PubChem CID 95971403) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is N-[(1R)-1-[3-(1,2,4-triazol-1-yl)phenyl]ethyl]ethanesulfonamide.
| Compound Name | N-[(1R)-1-[3-(1,2,4-triazol-1-yl)phenyl]ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 95971403 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-[(1R)-1-[3-(1,2,4-triazol-1-yl)phenyl]ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N[C@H](C)c1cccc(-n2cncn2)c1 |
| InChI | InChI=1S/C12H16N4O2S/c1-3-19(17,18)15-10(2)11-5-4-6-12(7-11)16-9-13-8-14-16/h4-10,15H,3H2,1-2H3/t10-/m1/s1 |
| InChIKey | RXTWKCZBRPGDAI-SNVBAGLBSA-N |
| XLogP | 1.27 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |