C11H11N3O3 — CID 117337585
methyl 2-hydroxy-2-[3-(1,2,4-triazol-1-yl)phenyl]acetate (PubChem CID 117337585) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is methyl 2-hydroxy-2-[3-(1,2,4-triazol-1-yl)phenyl]acetate.
| Compound Name | methyl 2-hydroxy-2-[3-(1,2,4-triazol-1-yl)phenyl]acetate |
|---|---|
| PubChem CID | 117337585 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | methyl 2-hydroxy-2-[3-(1,2,4-triazol-1-yl)phenyl]acetate |
| SMILES | COC(=O)C(O)c1cccc(-n2cncn2)c1 |
| InChI | InChI=1S/C11H11N3O3/c1-17-11(16)10(15)8-3-2-4-9(5-8)14-7-12-6-13-14/h2-7,10,15H,1H3 |
| InChIKey | WEXXXSCDZHJSQF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |