C18H26ClN3O2 — CID 66978422
7-(3-chlorophenoxy)-2,2-dimethyl-3-(1,2,4-triazol-1-ylmethyl)heptan-3-ol (PubChem CID 66978422) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 7-(3-chlorophenoxy)-2,2-dimethyl-3-(1,2,4-triazol-1-ylmethyl)heptan-3-ol.
| Compound Name | 7-(3-chlorophenoxy)-2,2-dimethyl-3-(1,2,4-triazol-1-ylmethyl)heptan-3-ol |
|---|---|
| PubChem CID | 66978422 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 7-(3-chlorophenoxy)-2,2-dimethyl-3-(1,2,4-triazol-1-ylmethyl)heptan-3-ol |
| SMILES | CC(C)(C)C(O)(CCCCOc1cccc(Cl)c1)Cn1cncn1 |
| InChI | InChI=1S/C18H26ClN3O2/c1-17(2,3)18(23,12-22-14-20-13-21-22)9-4-5-10-24-16-8-6-7-15(19)11-16/h6-8,11,13-14,23H,4-5,9-10,12H2,1-3H3 |
| InChIKey | NRTKRFUIVQWMPB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|