C17H23ClFN3O2 — CID 141305889
6-(4-chloro-2-fluorophenoxy)-2,2-dimethyl-3-(1,2,4-triazol-1-ylmethyl)hexan-3-ol (PubChem CID 141305889) has the molecular formula C17H23ClFN3O2 and a molecular weight of 355.84 g/mol. Its IUPAC name is 6-(4-chloro-2-fluorophenoxy)-2,2-dimethyl-3-(1,2,4-triazol-1-ylmethyl)hexan-3-ol.
| Compound Name | 6-(4-chloro-2-fluorophenoxy)-2,2-dimethyl-3-(1,2,4-triazol-1-ylmethyl)hexan-3-ol |
|---|---|
| PubChem CID | 141305889 |
| Molecular Formula | C17H23ClFN3O2 |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 6-(4-chloro-2-fluorophenoxy)-2,2-dimethyl-3-(1,2,4-triazol-1-ylmethyl)hexan-3-ol |
| SMILES | CC(C)(C)C(O)(CCCOc1ccc(Cl)cc1F)Cn1cncn1 |
| InChI | InChI=1S/C17H23ClFN3O2/c1-16(2,3)17(23,10-22-12-20-11-21-22)7-4-8-24-15-6-5-13(18)9-14(15)19/h5-6,9,11-12,23H,4,7-8,10H2,1-3H3 |
| InChIKey | BANIFNKWUJCARB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|