C16H16N4O2 — CID 71986351
3-[[3-(1,2,4-triazol-1-yl)phenoxy]methyl]-4,5,6,7-tetrahydro-1,2-benzoxazole (PubChem CID 71986351) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-[[3-(1,2,4-triazol-1-yl)phenoxy]methyl]-4,5,6,7-tetrahydro-1,2-benzoxazole.
| Compound Name | 3-[[3-(1,2,4-triazol-1-yl)phenoxy]methyl]-4,5,6,7-tetrahydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 71986351 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-[[3-(1,2,4-triazol-1-yl)phenoxy]methyl]-4,5,6,7-tetrahydro-1,2-benzoxazole |
| SMILES | c1cc(OCc2noc3c2CCCC3)cc(-n2cncn2)c1 |
| InChI | InChI=1S/C16H16N4O2/c1-2-7-16-14(6-1)15(19-22-16)9-21-13-5-3-4-12(8-13)20-11-17-10-18-20/h3-5,8,10-11H,1-2,6-7,9H2 |
| InChIKey | JZSXMIJQWNEAPT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |