C16H14N4O2 — CID 69123933
3-[[4-(1,2,4-triazol-1-yl)phenyl]methoxy]benzamide (PubChem CID 69123933) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 3-[[4-(1,2,4-triazol-1-yl)phenyl]methoxy]benzamide.
| Compound Name | 3-[[4-(1,2,4-triazol-1-yl)phenyl]methoxy]benzamide |
|---|---|
| PubChem CID | 69123933 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-[[4-(1,2,4-triazol-1-yl)phenyl]methoxy]benzamide |
| SMILES | NC(=O)c1cccc(OCc2ccc(-n3cncn3)cc2)c1 |
| InChI | InChI=1S/C16H14N4O2/c17-16(21)13-2-1-3-15(8-13)22-9-12-4-6-14(7-5-12)20-11-18-10-19-20/h1-8,10-11H,9H2,(H2,17,21) |
| InChIKey | NDDHZGZECIFZDU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |