C20H16N4O2S — CID 55670767
3-(thiophen-2-ylmethoxy)-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide (PubChem CID 55670767) has the molecular formula C20H16N4O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is 3-(thiophen-2-ylmethoxy)-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide.
| Compound Name | 3-(thiophen-2-ylmethoxy)-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55670767 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 3-(thiophen-2-ylmethoxy)-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-n2cncn2)cc1)c1cccc(OCc2cccs2)c1 |
| InChI | InChI=1S/C20H16N4O2S/c25-20(23-16-6-8-17(9-7-16)24-14-21-13-22-24)15-3-1-4-18(11-15)26-12-19-5-2-10-27-19/h1-11,13-14H,12H2,(H,23,25) |
| InChIKey | ITEPICLDESBWHJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |