C22H18N4O2 — CID 55566637
2-(phenoxymethyl)-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide (PubChem CID 55566637) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-(phenoxymethyl)-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide.
| Compound Name | 2-(phenoxymethyl)-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55566637 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-(phenoxymethyl)-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-n2cncn2)cc1)c1ccccc1COc1ccccc1 |
| InChI | InChI=1S/C22H18N4O2/c27-22(25-18-10-12-19(13-11-18)26-16-23-15-24-26)21-9-5-4-6-17(21)14-28-20-7-2-1-3-8-20/h1-13,15-16H,14H2,(H,25,27) |
| InChIKey | IPCLYDSBZUEADQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |