C22H17N3O3S — CID 49033817
N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-3-(thiophen-2-ylmethoxy)benzamide (PubChem CID 49033817) has the molecular formula C22H17N3O3S and a molecular weight of 403.46 g/mol. Its IUPAC name is N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-3-(thiophen-2-ylmethoxy)benzamide.
| Compound Name | N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-3-(thiophen-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 49033817 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]-3-(thiophen-2-ylmethoxy)benzamide |
| SMILES | O=C(Nc1cccc(-c2ccc(=O)[nH]n2)c1)c1cccc(OCc2cccs2)c1 |
| InChI | InChI=1S/C22H17N3O3S/c26-21-10-9-20(24-25-21)15-4-1-6-17(12-15)23-22(27)16-5-2-7-18(13-16)28-14-19-8-3-11-29-19/h1-13H,14H2,(H,23,27)(H,25,26) |
| InChIKey | HCLJGDIPYOOOEA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |