C18H13N5 — CID 141294128
2-[3-(4-imidazol-1-ylphenyl)phenyl]-1,3,5-triazine (PubChem CID 141294128) has the molecular formula C18H13N5 and a molecular weight of 299.34 g/mol. Its IUPAC name is 2-[3-(4-imidazol-1-ylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[3-(4-imidazol-1-ylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 141294128 |
| Molecular Formula | C18H13N5 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[3-(4-imidazol-1-ylphenyl)phenyl]-1,3,5-triazine |
| SMILES | c1cc(-c2ccc(-n3ccnc3)cc2)cc(-c2ncncn2)c1 |
| InChI | InChI=1S/C18H13N5/c1-2-15(10-16(3-1)18-21-11-20-12-22-18)14-4-6-17(7-5-14)23-9-8-19-13-23/h1-13H |
| InChIKey | XBYUMXKVGLMAAV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |