C9H9BrN4 — CID 107275092
[2-bromo-4-(1,2,4-triazol-1-yl)phenyl]methanamine (PubChem CID 107275092) has the molecular formula C9H9BrN4 and a molecular weight of 253.10 g/mol. Its IUPAC name is [2-bromo-4-(1,2,4-triazol-1-yl)phenyl]methanamine.
| Compound Name | [2-bromo-4-(1,2,4-triazol-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 107275092 |
| Molecular Formula | C9H9BrN4 |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | [2-bromo-4-(1,2,4-triazol-1-yl)phenyl]methanamine |
| SMILES | NCc1ccc(-n2cncn2)cc1Br |
| InChI | InChI=1S/C9H9BrN4/c10-9-3-8(2-1-7(9)4-11)14-6-12-5-13-14/h1-3,5-6H,4,11H2 |
| InChIKey | XATFIUZTAHAKJE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |