C25H22F17N — CID 87882921
N-ethyl-1,1,2,2,3,3-hexafluorononan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene (PubChem CID 87882921) has the molecular formula C25H22F17N and a molecular weight of 659.42 g/mol. Its IUPAC name is N-ethyl-1,1,2,2,3,3-hexafluorononan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene.
| Compound Name | N-ethyl-1,1,2,2,3,3-hexafluorononan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 87882921 |
| Molecular Formula | C25H22F17N |
| Molecular Weight | 659.42 g/mol |
| Exact Mass | 659.15 |
| IUPAC Name | N-ethyl-1,1,2,2,3,3-hexafluorononan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)NCC.Cc1c(F)c(F)c(F)c(C(F)(F)F)c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H3F11.C11H19F6N/c1-2-3(4-7(16)11(20)13(22)12(21)8(4)17)5(14(23,24)25)9(18)10(19)6(2)15;1-3-5-6-7-8-9(12,13)10(14,15)11(16,17)18-4-2/h1H3;18H,3-8H2,1-2H3 |
| InChIKey | IFAVLKVGHYMUKY-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.42 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|